* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[4-(THIOPHEN-2-YL)-1,3-THIAZOL-2-YL]PIPERIDINE |
English Synonyms: | 2-[4-(THIOPHEN-2-YL)-1,3-THIAZOL-2-YL]PIPERIDINE |
MDL Number.: | MFCD16789589 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1)c2csc(n2)C3CCCCN3 |
InChi: | InChI=1S/C12H14N2S2/c1-2-6-13-9(4-1)12-14-10(8-16-12)11-5-3-7-15-11/h3,5,7-9,13H,1-2,4,6H2 |
InChiKey: | InChIKey=XXDKMQHESJPVLT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.