* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338091 |
English Synonyms: | UKRORGSYN-BB BBV-34338091 |
MDL Number.: | MFCD16790379 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)CNCCN(C)Cc1cccs1 |
InChi: | InChI=1S/C12H22N2S/c1-11(2)9-13-6-7-14(3)10-12-5-4-8-15-12/h4-5,8,11,13H,6-7,9-10H2,1-3H3 |
InChiKey: | InChIKey=BBUPHQYTPAGNKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.