* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338097 |
English Synonyms: | UKRORGSYN-BB BBV-34338097 |
MDL Number.: | MFCD16790385 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCNCC(C)N(C)Cc1ccco1 |
InChi: | InChI=1S/C11H20N2O/c1-4-12-8-10(2)13(3)9-11-6-5-7-14-11/h5-7,10,12H,4,8-9H2,1-3H3 |
InChiKey: | InChIKey=GSLNGWNRTYFVCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.