* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34338733 |
English Synonyms: | UKRORGSYN-BB BBV-34338733 |
MDL Number.: | MFCD16790998 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCN(CCN(C)C)C(C)CNCC |
InChi: | InChI=1S/C12H29N3/c1-6-8-15(10-9-14(4)5)12(3)11-13-7-2/h12-13H,6-11H2,1-5H3 |
InChiKey: | InChIKey=AXLOSPPGENXWKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.