* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34340421 |
English Synonyms: | UKRORGSYN-BB BBV-34340421 |
MDL Number.: | MFCD16792283 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cc(cn1)C(=O)NCC2CCCN2 |
InChi: | InChI=1S/C10H16N4O/c1-14-7-8(5-13-14)10(15)12-6-9-3-2-4-11-9/h5,7,9,11H,2-4,6H2,1H3,(H,12,15) |
InChiKey: | InChIKey=CNUWGOMXQWRGSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.