* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-(2-METHOXYETHYL)-3-(1,3-THIAZOL-2-YL)THIOLAN-3-AMINE |
| English Synonyms: | N-(2-METHOXYETHYL)-3-(1,3-THIAZOL-2-YL)THIOLAN-3-AMINE |
| MDL Number.: | MFCD16793047 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COCCNC1(CCSC1)c2nccs2 |
| InChi: | InChI=1S/C10H16N2OS2/c1-13-5-3-12-10(2-6-14-8-10)9-11-4-7-15-9/h4,7,12H,2-3,5-6,8H2,1H3 |
| InChiKey: | InChIKey=KEQMOVAQAWCMRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.