* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([4-(5-METHYLFURAN-2-YL)-1,3-THIAZOL-2-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([4-(5-METHYLFURAN-2-YL)-1,3-THIAZOL-2-YL]METHYL))AMINE |
| MDL Number.: | MFCD16793518 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(o1)c2csc(n2)CNC |
| InChi: | InChI=1S/C10H12N2OS/c1-7-3-4-9(13-7)8-6-14-10(12-8)5-11-2/h3-4,6,11H,5H2,1-2H3 |
| InChiKey: | InChIKey=WVPNYBKUFJCQEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.