* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([5-(PROPAN-2-YL)-4H,5H,6H,7H-[1,3]THIAZOLO[5,4-C]PYRIDIN-2-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([5-(PROPAN-2-YL)-4H,5H,6H,7H-[1,3]THIAZOLO[5,4-C]PYRIDIN-2-YL]METHYL))AMINE |
| MDL Number.: | MFCD16793519 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)N1CCc2c(sc(n2)CNC)C1 |
| InChi: | InChI=1S/C11H19N3S/c1-8(2)14-5-4-9-10(7-14)15-11(13-9)6-12-3/h8,12H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=CLBQEFBJJIDTTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.