* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([4-(THIOPHEN-3-YL)-1,3-THIAZOL-2-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([4-(THIOPHEN-3-YL)-1,3-THIAZOL-2-YL]METHYL))AMINE |
| MDL Number.: | MFCD16793521 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CNCc1nc(cs1)c2ccsc2 |
| InChi: | InChI=1S/C9H10N2S2/c1-10-4-9-11-8(6-13-9)7-2-3-12-5-7/h2-3,5-6,10H,4H2,1H3 |
| InChiKey: | InChIKey=YATOZWLWFNMLNS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.