* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL((4H,6H,7H-THIOPYRANO[4,3-D][1,3]THIAZOL-2-YLMETHYL))AMINE |
| English Synonyms: | METHYL((4H,6H,7H-THIOPYRANO[4,3-D][1,3]THIAZOL-2-YLMETHYL))AMINE |
| MDL Number.: | MFCD16793529 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CNCc1nc2c(s1)CSCC2 |
| InChi: | InChI=1S/C8H12N2S2/c1-9-4-8-10-6-2-3-11-5-7(6)12-8/h9H,2-5H2,1H3 |
| InChiKey: | InChIKey=MGKRESFKIJDAEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.