* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-36639156 |
English Synonyms: | UKRORGSYN-BB BBV-36639156 |
MDL Number.: | MFCD16793541 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNCc1nc(cs1)c2cccc(c2)F |
InChi: | InChI=1S/C12H13FN2S/c1-2-14-7-12-15-11(8-16-12)9-4-3-5-10(13)6-9/h3-6,8,14H,2,7H2,1H3 |
InChiKey: | InChIKey=CYUKCZYIXUTNPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.