* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-36639165 |
English Synonyms: | UKRORGSYN-BB BBV-36639165 |
MDL Number.: | MFCD16793550 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNCc1nc2c(s1)CCC2 |
InChi: | InChI=1S/C9H14N2S/c1-2-10-6-9-11-7-4-3-5-8(7)12-9/h10H,2-6H2,1H3 |
InChiKey: | InChIKey=BNIAMRLMFUCOSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.