* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(5-BROMOTHIOPHEN-2-YL)-4H,5H,6H,7H-[1,3]THIAZOLO[5,4-C]PYRIDINE |
English Synonyms: | 2-(5-BROMOTHIOPHEN-2-YL)-4H,5H,6H,7H-[1,3]THIAZOLO[5,4-C]PYRIDINE |
MDL Number.: | MFCD16794825 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1c2nc3c(s2)CNCC3)Br |
InChi: | InChI=1S/C10H9BrN2S2/c11-9-2-1-7(14-9)10-13-6-3-4-12-5-8(6)15-10/h1-2,12H,3-5H2 |
InChiKey: | InChIKey=OOMVGHKPNFRHQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.