* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41804945 |
English Synonyms: | UKRORGSYN-BB BBV-41804945 |
MDL Number.: | MFCD16794827 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccsc1c2nc3c(s2)CNCC3 |
InChi: | InChI=1S/C11H12N2S2/c1-7-3-5-14-10(7)11-13-8-2-4-12-6-9(8)15-11/h3,5,12H,2,4,6H2,1H3 |
InChiKey: | InChIKey=IRBKUGNEFMVFBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.