* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDIN-2-YL)PHENOL |
| CAS: | 1174738-34-1 |
| English Synonyms: | 4-(4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDIN-2-YL)PHENOL |
| MDL Number.: | MFCD16794828 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1c2nc3c(s2)CNCC3)O |
| InChi: | InChI=1S/C12H12N2OS/c15-9-3-1-8(2-4-9)12-14-10-5-6-13-7-11(10)16-12/h1-4,13,15H,5-7H2 |
| InChiKey: | InChIKey=ALHQMCVTOYKMJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.