* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34344231 |
English Synonyms: | UKRORGSYN-BB BBV-34344231 |
MDL Number.: | MFCD16795483 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCN(CC)CCNCc1cccs1 |
InChi: | InChI=1S/C13H24N2S/c1-3-5-9-15(4-2)10-8-14-12-13-7-6-11-16-13/h6-7,11,14H,3-5,8-10,12H2,1-2H3 |
InChiKey: | InChIKey=UGOXDXHVBKUHRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.