* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34344860 |
English Synonyms: | UKRORGSYN-BB BBV-34344860 |
MDL Number.: | MFCD16796111 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCN(C)CCNc1ccc(cc1)Br |
InChi: | InChI=1S/C12H19BrN2/c1-3-9-15(2)10-8-14-12-6-4-11(13)5-7-12/h4-7,14H,3,8-10H2,1-2H3 |
InChiKey: | InChIKey=RBWFVHJUGFRBDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.