* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34345543 |
English Synonyms: | UKRORGSYN-BB BBV-34345543 |
MDL Number.: | MFCD16796740 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC(c1cccs1)NCCNC |
InChi: | InChI=1S/C9H16N2S/c1-8(11-6-5-10-2)9-4-3-7-12-9/h3-4,7-8,10-11H,5-6H2,1-2H3 |
InChiKey: | InChIKey=ZXNUQPHNCFHJQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.