* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34347500 |
English Synonyms: | UKRORGSYN-BB BBV-34347500 |
MDL Number.: | MFCD16798606 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(CNCc1ccco1)NCCOC |
InChi: | InChI=1S/C11H20N2O2/c1-10(13-5-7-14-2)8-12-9-11-4-3-6-15-11/h3-4,6,10,12-13H,5,7-9H2,1-2H3 |
InChiKey: | InChIKey=ILCLKFBCIYBAPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.