* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PENTYL((1-[(PROP-2-YN-1-YL)AMINO]PROPAN-2-YL))(PROPAN-2-YL)AMINE |
| English Synonyms: | PENTYL((1-[(PROP-2-YN-1-YL)AMINO]PROPAN-2-YL))(PROPAN-2-YL)AMINE |
| MDL Number.: | MFCD16798772 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCCN(C(C)C)C(C)CNCC#C |
| InChi: | InChI=1S/C14H28N2/c1-6-8-9-11-16(13(3)4)14(5)12-15-10-7-2/h2,13-15H,6,8-12H2,1,3-5H3 |
| InChiKey: | InChIKey=OPWAJIIUUYBHLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.