* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348174 |
English Synonyms: | UKRORGSYN-BB BBV-34348174 |
MDL Number.: | MFCD16799242 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(CNCc1ccco1)n2cccn2 |
InChi: | InChI=1S/C11H15N3O/c1-10(14-6-3-5-13-14)8-12-9-11-4-2-7-15-11/h2-7,10,12H,8-9H2,1H3 |
InChiKey: | InChIKey=DJDIQRFJGXQMRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.