* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348222 |
English Synonyms: | UKRORGSYN-BB BBV-34348222 |
MDL Number.: | MFCD16799290 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ncn(n1)CCNCC2CCCC2 |
InChi: | InChI=1S/C10H18N4/c1-2-4-10(3-1)7-11-5-6-14-9-12-8-13-14/h8-11H,1-7H2 |
InChiKey: | InChIKey=YSLRQEWSURGDQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.