* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348230 |
English Synonyms: | UKRORGSYN-BB BBV-34348230 |
MDL Number.: | MFCD16799298 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cocc1CNCCn2cncn2 |
InChi: | InChI=1S/C9H12N4O/c1-4-14-6-9(1)5-10-2-3-13-8-11-7-12-13/h1,4,6-8,10H,2-3,5H2 |
InChiKey: | InChIKey=KVNNULLXSFWKFG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.