Molecular Structure:
CCD No.:CCD03179512
OTAVA-BB 2031032
Formula:C10 H13 N3 O S
MolWeight:223.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2031032 |
| English Synonyms： | OTAVA-BB 2031032 |
| MDL Number.： | MFCD16799418 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1csc2c1c(=O)n(cn2)CCCCN |
| InChi： | InChI=1S/C10H13N3OS/c11-4-1-2-5-13-7-12-9-8(10(13)14)3-6-15-9/h3,6-7H,1-2,4-5,11H2 |
| InChiKey： | InChIKey=ZDFLMFZYFISMKY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
