* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| English Synonyms: | 3-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| MDL Number.: | MFCD16799422 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C=CCNCCn1c2ccccc2oc1=O |
| InChi: | InChI=1S/C12H14N2O2/c1-2-7-13-8-9-14-10-5-3-4-6-11(10)16-12(14)15/h2-6,13H,1,7-9H2 |
| InChiKey: | InChIKey=AZELQPNKNWXETM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.