* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-1-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-1,2-DIHYDROPYRIDIN-2-ONE |
| English Synonyms: | 5-BROMO-1-(2-[(PROP-2-EN-1-YL)AMINO]ETHYL)-1,2-DIHYDROPYRIDIN-2-ONE |
| MDL Number.: | MFCD16799435 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C=CCNCCn1cc(ccc1=O)Br |
| InChi: | InChI=1S/C10H13BrN2O/c1-2-5-12-6-7-13-8-9(11)3-4-10(13)14/h2-4,8,12H,1,5-7H2 |
| InChiKey: | InChIKey=UANVKFDALZXRNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.