* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348889 |
English Synonyms: | UKRORGSYN-BB BBV-34348889 |
MDL Number.: | MFCD16799949 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1c(c(n(n1)CCNCCOC)C)Cl |
InChi: | InChI=1S/C10H18ClN3O/c1-8-10(11)9(2)14(13-8)6-4-12-5-7-15-3/h12H,4-7H2,1-3H3 |
InChiKey: | InChIKey=AFUSLAMFWGNQDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.