* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348898 |
English Synonyms: | UKRORGSYN-BB BBV-34348898 |
MDL Number.: | MFCD16799958 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)cnn2CCNCC3CC3 |
InChi: | InChI=1S/C13H17N3/c1-2-4-13-12(3-1)10-15-16(13)8-7-14-9-11-5-6-11/h1-4,10-11,14H,5-9H2 |
InChiKey: | InChIKey=DTSUPSJWRDHDBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.