* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348920 |
English Synonyms: | UKRORGSYN-BB BBV-34348920 |
MDL Number.: | MFCD16799978 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCNCCn1cc(cn1)Cl |
InChi: | InChI=1S/C9H16ClN3/c1-2-3-4-11-5-6-13-8-9(10)7-12-13/h7-8,11H,2-6H2,1H3 |
InChiKey: | InChIKey=GOJXEVUFKCAEPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.