* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349105 |
English Synonyms: | UKRORGSYN-BB BBV-34349105 |
MDL Number.: | MFCD16800163 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(oc1)c2nnn(n2)CCCN |
InChi: | InChI=1S/C8H11N5O/c9-4-2-5-13-11-8(10-12-13)7-3-1-6-14-7/h1,3,6H,2,4-5,9H2 |
InChiKey: | InChIKey=DFOZCZUIKHRDNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.