* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349150 |
English Synonyms: | UKRORGSYN-BB BBV-34349150 |
MDL Number.: | MFCD16800208 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1c(nn(c1C)CCNCCOC)C |
InChi: | InChI=1S/C12H23N3O/c1-5-12-10(2)14-15(11(12)3)8-6-13-7-9-16-4/h13H,5-9H2,1-4H3 |
InChiKey: | InChIKey=SYQKGLNCMKFGRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.