* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349187 |
English Synonyms: | UKRORGSYN-BB BBV-34349187 |
MDL Number.: | MFCD16800245 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNCC#C |
InChi: | InChI=1S/C10H15N3/c1-3-5-11-6-8-13-9-7-12-10(13)4-2/h1,7,9,11H,4-6,8H2,2H3 |
InChiKey: | InChIKey=YLBMMJYPCIBGEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.