* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349198 |
English Synonyms: | UKRORGSYN-BB BBV-34349198 |
MDL Number.: | MFCD16800256 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNC2CCCC2 |
InChi: | InChI=1S/C12H21N3/c1-2-12-14-8-10-15(12)9-7-13-11-5-3-4-6-11/h8,10-11,13H,2-7,9H2,1H3 |
InChiKey: | InChIKey=FMJPMQYTNASEAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.