* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349253 |
English Synonyms: | UKRORGSYN-BB BBV-34349253 |
MDL Number.: | MFCD16800311 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CNCCCCn1ccnc1c2cccs2 |
InChi: | InChI=1S/C12H17N3S/c1-13-6-2-3-8-15-9-7-14-12(15)11-5-4-10-16-11/h4-5,7,9-10,13H,2-3,6,8H2,1H3 |
InChiKey: | InChIKey=KFWYHTZNHCUKDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.