* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34350057 |
English Synonyms: | UKRORGSYN-BB BBV-34350057 |
MDL Number.: | MFCD16801102 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)CC(C)OCCNCc1cccs1 |
InChi: | InChI=1S/C13H23NOS/c1-11(2)9-12(3)15-7-6-14-10-13-5-4-8-16-13/h4-5,8,11-12,14H,6-7,9-10H2,1-3H3 |
InChiKey: | InChIKey=UEVJGWMOLLWPCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.