* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PENTYL[2-(PROP-2-EN-1-YLOXY)PROPYL]AMINE |
| English Synonyms: | PENTYL[2-(PROP-2-EN-1-YLOXY)PROPYL]AMINE |
| MDL Number.: | MFCD16801185 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCCNCC(C)OCC=C |
| InChi: | InChI=1S/C11H23NO/c1-4-6-7-8-12-10-11(3)13-9-5-2/h5,11-12H,2,4,6-10H2,1,3H3 |
| InChiKey: | InChIKey=JFYVLRZABWXKKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.