* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34350479 |
English Synonyms: | UKRORGSYN-BB BBV-34350479 |
MDL Number.: | MFCD16801489 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)CCCOCCNCc1ccco1 |
InChi: | InChI=1S/C13H23NO2/c1-12(2)5-3-8-15-10-7-14-11-13-6-4-9-16-13/h4,6,9,12,14H,3,5,7-8,10-11H2,1-2H3 |
InChiKey: | InChIKey=BIGRBCRFRYHQMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.