* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351889 |
English Synonyms: | UKRORGSYN-BB BBV-34351889 |
MDL Number.: | MFCD16802866 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cocc1CNCCOC2CCOCC2 |
InChi: | InChI=1S/C12H19NO3/c1-5-15-10-11(1)9-13-4-8-16-12-2-6-14-7-3-12/h1,5,10,12-13H,2-4,6-9H2 |
InChiKey: | InChIKey=KRABASDSPXATHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.