* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351920 |
English Synonyms: | UKRORGSYN-BB BBV-34351920 |
MDL Number.: | MFCD16802897 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCNCC(C)OCc1cccs1 |
InChi: | InChI=1S/C12H21NOS/c1-3-4-7-13-9-11(2)14-10-12-6-5-8-15-12/h5-6,8,11,13H,3-4,7,9-10H2,1-2H3 |
InChiKey: | InChIKey=TZTCRHGJCNNCRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.