* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352443 |
English Synonyms: | UKRORGSYN-BB BBV-34352443 |
MDL Number.: | MFCD16803419 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1nnc(s1)SCCNCC2CCCCC2 |
InChi: | InChI=1S/C11H19N3S2/c1-2-4-10(5-3-1)8-12-6-7-15-11-14-13-9-16-11/h9-10,12H,1-8H2 |
InChiKey: | InChIKey=PBJRVZCFXSCAER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.