* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352462 |
English Synonyms: | UKRORGSYN-BB BBV-34352462 |
MDL Number.: | MFCD16803438 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(s1)CNCCSc2nncs2 |
InChi: | InChI=1S/C10H13N3S3/c1-8-2-3-9(16-8)6-11-4-5-14-10-13-12-7-15-10/h2-3,7,11H,4-6H2,1H3 |
InChiKey: | InChIKey=ATFKHVFCDQWMHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.