* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352550 |
English Synonyms: | UKRORGSYN-BB BBV-34352550 |
MDL Number.: | MFCD16803526 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1csc(n1)SC(C)CNC(C)C |
InChi: | InChI=1S/C10H18N2S2/c1-7(2)11-5-9(4)14-10-12-8(3)6-13-10/h6-7,9,11H,5H2,1-4H3 |
InChiKey: | InChIKey=OQPCUJSVYIHBFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.