* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352577 |
English Synonyms: | UKRORGSYN-BB BBV-34352577 |
MDL Number.: | MFCD16803553 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNCC(C)Sc1nc2ccccc2s1 |
InChi: | InChI=1S/C12H16N2S2/c1-3-13-8-9(2)15-12-14-10-6-4-5-7-11(10)16-12/h4-7,9,13H,3,8H2,1-2H3 |
InChiKey: | InChIKey=XCHDNSDFGWKCCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.