* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352656 |
English Synonyms: | UKRORGSYN-BB BBV-34352656 |
MDL Number.: | MFCD16803631 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCC(CC)NCCSc1nnnn1C |
InChi: | InChI=1S/C9H19N5S/c1-4-8(5-2)10-6-7-15-9-11-12-13-14(9)3/h8,10H,4-7H2,1-3H3 |
InChiKey: | InChIKey=RFCDAHYKRNAAKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.