* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352700 |
English Synonyms: | UKRORGSYN-BB BBV-34352700 |
MDL Number.: | MFCD16803674 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(COC)NCCSc1[nH]ncn1 |
InChi: | InChI=1S/C8H16N4OS/c1-7(5-13-2)9-3-4-14-8-10-6-11-12-8/h6-7,9H,3-5H2,1-2H3,(H,10,11,12) |
InChiKey: | InChIKey=CLOKADQRFVTGJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.