* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34353234 |
English Synonyms: | UKRORGSYN-BB BBV-34353234 |
MDL Number.: | MFCD16804204 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCSCCNCc1ccc(s1)Cl |
InChi: | InChI=1S/C10H16ClNS2/c1-2-6-13-7-5-12-8-9-3-4-10(11)14-9/h3-4,12H,2,5-8H2,1H3 |
InChiKey: | InChIKey=JPKRAOKNLLQOOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.