* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34353350 |
English Synonyms: | UKRORGSYN-BB BBV-34353350 |
MDL Number.: | MFCD16804319 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(C)SCCNCc1ccoc1 |
InChi: | InChI=1S/C11H19NOS/c1-3-10(2)14-7-5-12-8-11-4-6-13-9-11/h4,6,9-10,12H,3,5,7-8H2,1-2H3 |
InChiKey: | InChIKey=KXSJRYRANHLYHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.