* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354509 |
English Synonyms: | UKRORGSYN-BB BBV-34354509 |
MDL Number.: | MFCD16805474 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CNCCSc2nccs2 |
InChi: | InChI=1S/C12H14N2S2/c1-2-4-11(5-3-1)10-13-6-8-15-12-14-7-9-16-12/h1-5,7,9,13H,6,8,10H2 |
InChiKey: | InChIKey=IKJHTHDLBPNEDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.