* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354513 |
English Synonyms: | UKRORGSYN-BB BBV-34354513 |
MDL Number.: | MFCD16805478 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)CNCCSc2nccs2 |
InChi: | InChI=1S/C11H13N3S2/c1-2-10(8-12-3-1)9-13-4-6-15-11-14-5-7-16-11/h1-3,5,7-8,13H,4,6,9H2 |
InChiKey: | InChIKey=QEUJYCSTOVKEGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.