* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354525 |
English Synonyms: | UKRORGSYN-BB BBV-34354525 |
MDL Number.: | MFCD16805490 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cocc1CNCCSc2nccs2 |
InChi: | InChI=1S/C10H12N2OS2/c1-4-13-8-9(1)7-11-2-5-14-10-12-3-6-15-10/h1,3-4,6,8,11H,2,5,7H2 |
InChiKey: | InChIKey=IEHFXACMESPEDB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.